Publicação
Assessment of the stability of catechin-enriched extracts obtained from Arbutus unedo L. fruits: Kinetic mathematical modeling of pH and temperature properties on powder and solution systems
| dc.contributor.author | Albuquerque, Bianca R. | |
| dc.contributor.author | Prieto Lage, Miguel A. | |
| dc.contributor.author | Barros, Lillian | |
| dc.contributor.author | Ferreira, Isabel C.F.R. | |
| dc.date.accessioned | 2018-01-25T10:00:00Z | |
| dc.date.accessioned | 2018-01-30T15:00:27Z | |
| dc.date.available | 2018-01-25T10:00:00Z | |
| dc.date.available | 2018-01-30T15:00:27Z | |
| dc.date.issued | 2017 | |
| dc.description.abstract | B.V. Arbutus unedo L. (strawberry-tree) fruits could be considered an alternative source of flavan-3-ols, in particular catechin and its derivatives. These compounds are known for a variety of applications in food (especially as food additives), pharmaceutical and cosmetic industry. Therefore, catechin-enriched extracts (60% flavan-3-ols and 22% of catechin) were obtained from A. unedo fruits and further submitted to physical and chemical stability studies, considering the main affecting variables (time, temperature and pH): i) a stability study of the extracts during the obtaining and storage procedures (powder system); and ii) a stability study of the extracts in simulated food environment (aqueous solution system). The measured responses were the flavan-3-ols and catechin contents, determined by High performance liquid chromatography couple to a diode array detector (HPLC-DAD), and the antioxidant activity of the extracts evaluated by hydrophilic assays. Mechanistic and phenomenological equations were used to describe the responses, and the optimal conditions for flavan-3-ols (including catechin) stability as powder extract during a month were pH = 5.4 and T = -20 °C; while its stability in aqueous solution remained during the 24 h of application at pH < 4 and T < 30 °C. These results provide useful information for: i) potential industrial use of A. unedo fruits as alternative sources of flavan-3-ols; and ii) shelf-life calculations and catechin loss predictions at specific conditions of temperature and pH. Finally, the results obtained showed a certain agreement with previous reports of catechin stability studies in powder and solution systems, but providing a new alternative source: A. unedo fruits. | pt_PT |
| dc.description.sponsorship | The authors thank the Foundation for Science and Tech-nology (FCT, Portugal) and FEDER under Program PT2020 forfinancial support to CIMO (UID/AGR/00690/2013) and L. Barros(SFRH/BPD/107855/2015) grant. To POCI-01-0145-FEDER-006984(LA LSRE-LCM), funded by FEDER, through POCI-COMPETE2020 and FCT. To Xunta de Galicia for financial support for the post-doctoralresearcher of M.A. Prieto. B. Albuquerque thanks Celeide Pereira(UTFPR, Brazil) for her master co-supervision. | |
| dc.description.version | info:eu-repo/semantics/publishedVersion | pt_PT |
| dc.identifier.citation | Albuquerque, Bianca R.; Prieto, M.A.; Barros, Lillian; Ferreira, Isabel C.F.R. (2017). Assessment of the stability of catechin-enriched extracts obtained from Arbutus unedo L. fruits: Kinetic mathematical modeling of pH and temperature properties on powder and solution systems. Industrial Crops and Products. ISSN 0926-6690. 99, p. 150-162 | en_EN |
| dc.identifier.doi | 10.1016/j.indcrop.2017.02.002 | pt_PT |
| dc.identifier.issn | 0926-6690 | |
| dc.identifier.uri | http://hdl.handle.net/10198/15297 | |
| dc.language.iso | eng | |
| dc.peerreviewed | yes | pt_PT |
| dc.relation | Mountain Research Centre - UID/AGR/00690/2013 | |
| dc.subject | Arbutus unedo L. fruits | en_EN |
| dc.subject | Catechin-enriched extract | en_EN |
| dc.subject | pH and temperature effects | en_EN |
| dc.subject | Physical and chemical stability | en_EN |
| dc.subject | Reaction kinetics modeling | en_EN |
| dc.title | Assessment of the stability of catechin-enriched extracts obtained from Arbutus unedo L. fruits: Kinetic mathematical modeling of pH and temperature properties on powder and solution systems | en_EN |
| dc.type | journal article | |
| dspace.entity.type | Publication | |
| oaire.awardNumber | UID/AGR/00690/2013 | |
| oaire.awardTitle | Mountain Research Centre - UID/AGR/00690/2013 | |
| oaire.awardURI | info:eu-repo/grantAgreement/FCT/6817 - DCRRNI ID/UID%2FAGR%2F00690%2F2013/PT | |
| oaire.fundingStream | 6817 - DCRRNI ID | |
| person.familyName | Albuquerque | |
| person.familyName | Prieto | |
| person.familyName | Barros | |
| person.familyName | Ferreira | |
| person.givenName | Bianca R. | |
| person.givenName | Miguel A. | |
| person.givenName | Lillian | |
| person.givenName | Isabel C.F.R. | |
| person.identifier | 107688 | |
| person.identifier | 469085 | |
| person.identifier | 144781 | |
| person.identifier.ciencia-id | 621C-B603-7519 | |
| person.identifier.ciencia-id | 221E-1E00-AB74 | |
| person.identifier.ciencia-id | 9616-35CB-D001 | |
| person.identifier.ciencia-id | 9418-CF95-9919 | |
| person.identifier.orcid | 0000-0003-4109-7921 | |
| person.identifier.orcid | 0000-0002-3513-0054 | |
| person.identifier.orcid | 0000-0002-9050-5189 | |
| person.identifier.orcid | 0000-0003-4910-4882 | |
| person.identifier.rid | G-4516-2011 | |
| person.identifier.rid | J-3600-2013 | |
| person.identifier.rid | E-8500-2013 | |
| person.identifier.scopus-author-id | 57192311941 | |
| person.identifier.scopus-author-id | 35937495700 | |
| person.identifier.scopus-author-id | 35236343600 | |
| person.identifier.scopus-author-id | 36868826600 | |
| project.funder.identifier | http://doi.org/10.13039/501100001871 | |
| project.funder.name | Fundação para a Ciência e a Tecnologia | |
| rcaap.rights | openAccess | en_EN |
| rcaap.type | article | pt_PT |
| relation.isAuthorOfPublication | c74e6f34-eab8-47bc-906b-dafb96b9f473 | |
| relation.isAuthorOfPublication | 13260615-fd28-4b8b-9dd4-8a8466007579 | |
| relation.isAuthorOfPublication | 3af07ffe-f914-48ba-a5d5-efcf70fdce01 | |
| relation.isAuthorOfPublication | bd0d1537-2e03-41fb-b27a-140af9c35db8 | |
| relation.isAuthorOfPublication.latestForDiscovery | 3af07ffe-f914-48ba-a5d5-efcf70fdce01 | |
| relation.isProjectOfPublication | 4ea87c92-7c6c-4468-9503-1c0c3301b5ac | |
| relation.isProjectOfPublication.latestForDiscovery | 4ea87c92-7c6c-4468-9503-1c0c3301b5ac |
